On Target 5HT7R_HUMAN 0.21818182/CHEMBL2401935
For the given ligand Y-1, we have found in our database that, being scored 0.21818182, the most similar ligand is CHEMBL2401935. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL2401935 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | Cl.COc1ccccc1N2CCN(Cc3ccc4Oc5ccccc5C(=O)c4c3)CC2 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 00004002 00200008 20080128 04010600 80001200 80000020 02000000 42001200 02004000 40010a40 00200024 40008000 40008c02 00202088 01000441 00004008 00040000 02000000 08000000 00020000 40100000 2a008008 20004020 02588002 08000020 c0000002 20000010 88100080 0800a300 01860000 00040800 00020200 |