On Target 5HT4R_HUMAN 0.2712766/CHEMBL2152922
For the given ligand Y-1, we have found in our database that, being scored 0.2712766, the most similar ligand is CHEMBL2152922. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL2152922 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | OC1(CN2CCC(COc3noc4cccc(O[C@@H]5CCOC5)c34)CC2)CCOCC1 |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04000081 01800018 201a0008 02010700 901c12c0 02009010 42001000 20000040 040a2200 010008c0 00200000 50018000 00800002 00401040 11280001 001c300c 11000801 00000084 09600002 00460201 00802020 38010008 07e010c0 0a180090 10000400 00010000 00000231 18800021 08010200 01068200 80000000 c0002a10 |