On Target MC5R_HUMAN 0.17061612/CHEMBL3938186
For the given ligand Y-1, we have found in our database that, being scored 0.17061612, the most similar ligand is CHEMBL3938186. Check out the elaboration below.
| Y-1 (Given Ligand) | CHEMBL3938186 (Similar Ligand) |
|---|---|
| O=c1ccocc1O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O | NC(=N)NCCC[C@@H]1N[C@H](CNC(=O)[C@@H]2COc3ccccc3O2)CCN(CC(c4ccccc4)c5ccccc5)C1=O |
|
|
|
|
|
|
| 0c000000 01200008 20080008 01010300 803d104c 82000800 00042800 00000000 02224000 01000060 40000080 40008000 40808400 02800088 11200000 002ab008 00800000 00000000 1148a000 00025003 00140020 08000400 05000000 0a180010 00400400 00000000 00000010 2c900020 01002200 01820201 01e00000 00b50000 | 04012000 01003408 20100108 04210e02 00001080 02200000 02000200 2100200c 00242280 000809e2 08240000 4003f000 1680d012 00002001 81381001 0218a008 10200000 82000000 00800002 00020201 08000000 382d0620 170000a3 8b500018 00000001 a0000000 40000008 50800001 0c000290 0006001b 80084000 000026c0 |