On Target NS5B_HCV1A 0.21839081/CHEMBL320324
For the given ligand DB06145, we have found in our database that, being scored 0.21839081, the most similar ligand is CHEMBL320324. Check out the elaboration below.
| DB06145 (Given Ligand) | CHEMBL320324 (Similar Ligand) |
|---|---|
| CO[C@H]2[C@H](O)CC(=O)O[C@H](C)C/C=C\C=C/[C@H](O[C@@H]1CC[C@@H](N(C)C)[C@@H](C)O1)[C@H](C)C[C@H](CC=O)[C@H]2O[C@@H]4O[C@H](C)[C@H](O[C@H]3C[C@@](C)(O)[C@@H](O)[C@@H](C)O3)[C@H](N(C)C)[C@@H]4O | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCC1)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00050040 01040000 00100100 80810700 c03801c0 00800001 02003800 08000440 00202000 011000a0 40200200 40009000 14028028 028a0000 0000140c 002a900c 00a20040 00000100 31c0a090 00008001 00100020 10001a00 1740a080 08000012 10001400 00000000 00406200 b4000020 00000242 00040000 24e20000 04000a10 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e00800a 00002001 80000000 001a0408 000a0000 00080001 00c02810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 03040001 a0024000 00002200 |