On Target NSP1_SARS 0.33333334/CHEMBL1092796
For the given ligand DB01222, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1092796. Check out the elaboration below.
| DB01222 (Given Ligand) | CHEMBL1092796 (Similar Ligand) |
|---|---|
| CCC[C@H]5O[C@H]4C[C@H]3[C@@H]2CC/C1=C/C(=O)/C=C\[C@]1(C)[C@H]2[C@H](O)C[C@]3(C)[C@]4(C(=O)CO)O5 | CC1=CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
|
|
|
|
|
|
| 00010042 81000000 00000000 00090100 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00800000 80000000 1341a000 00022001 00000021 00000280 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 01000000 24a20000 00000000 | 00000402 01040000 00000800 00080000 40402000 00000001 00000080 02000402 01000000 00100000 00000200 40404200 80028000 20000000 00000404 0008040c 00000000 00000020 02092080 00020001 00002001 00000280 01008000 00000812 00200000 00000000 00404240 80800000 00004000 00000000 24820000 04000000 |