On Target OPRM_HUMAN 0.5754717/CHEMBL257264
For the given ligand vs-17, we have found in our database that, being scored 0.5754717, the most similar ligand is CHEMBL257264. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL257264 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CN(C)C[C@H]1CCCC[C@]1(OCCO)c2cccc(O)c2 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000000 4b000208 a0100102 00010700 00080010 40004000 02000000 00000000 00000900 000808c8 08300000 40018000 00000002 00a90000 00000000 020c9008 00a00000 02000000 02c02000 00020201 00000120 18000030 05000080 08500010 00000400 80002000 00080000 10000020 00000202 0006000a 40020000 00000600 |