On Target NPSR1_HUMAN 0.34117648/CHEMBL1801358
For the given ligand vs-17, we have found in our database that, being scored 0.34117648, the most similar ligand is CHEMBL1801358. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL1801358 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1ccc2c(c1)C(CC3CCOCC3)(c4ccc(Cl)cc4)n5ccnc25 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 0000c102 47800208 2010010a 10010700 a0081060 40002000 02040400 01081000 80000900 100818c4 08108008 40018800 03001866 21a00000 018200a1 020d100c 00800000 0e002000 00482000 00420201 80100120 38008110 21005040 81528011 00002400 e0000001 00060000 50014080 06000286 0046080a 400c0800 00020400 |