On Target PTAFR_HUMAN 0.74725276/CHEMBL297624
For the given ligand vs-17, we have found in our database that, being scored 0.74725276, the most similar ligand is CHEMBL297624. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL297624 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cc(cc(OC)c1OC)[C@H]2CC[C@@H](O2)c3cc(OC)c(OC)c(OC)c3 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00000001 4b000008 2000010a 00010200 00081010 40004000 42040000 00000000 00000900 00080848 08100000 40008000 00004002 20210000 01080005 02088008 00000000 02000204 00482000 00020a01 00000120 08000020 01000000 00400010 00000400 80002000 005a0000 00000000 00000202 0002000a 40000000 02000400 |