On Target GRM2_HUMAN 0.42727274/CHEMBL341457
For the given ligand vs-17, we have found in our database that, being scored 0.42727274, the most similar ligand is CHEMBL341457. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL341457 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | COc1cccc(CC[C@@](N)(C2C[C@@H]2C(=O)O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 00030000 43000208 2000010a 00010600 00181000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 23a00000 01000001 00080008 00000000 02000000 00482000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000202 0006000a 00020000 00400400 |