On Target 5HT6R_HUMAN 0.44144145/CHEMBL484608
For the given ligand vs-17, we have found in our database that, being scored 0.44144145, the most similar ligand is CHEMBL484608. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL484608 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | Cc1cccc(COc2cccc(C3CCNCC3)c2C)c1 |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 43000208 20100108 00010600 00001001 40004000 02000000 20000000 00000900 000808c0 08300000 50018000 00800002 20210080 01000001 020c2008 00000000 02008000 00080000 40020201 00000100 18000020 00004000 00c01010 00004000 80002001 00000000 10000000 00000300 0006000a 40000004 00000600 |