On Target 5HT2B_HUMAN 0.44094488/CHEMBL454770
For the given ligand vs-17, we have found in our database that, being scored 0.44094488, the most similar ligand is CHEMBL454770. Check out the elaboration below.
| vs-17 (Given Ligand) | CHEMBL454770 (Similar Ligand) |
|---|---|
| COc3cc(C[C@@H]2CO[C@H](c1ccc(O)c(OC)c1)[C@]2(O)CO)ccc3O | CNC[C@]1(O)Cc2ccccc2[C@@H]1Oc3ccc(O)cc3C |
|
|
|
|
|
|
| 00000040 4b000008 2000010a 00010300 00281051 40004000 02000000 00000000 00000900 01080848 08100000 40008000 00004002 20210000 010c0005 02089008 08800000 02000000 11482000 00020201 00000120 08000020 05000040 08400010 00000400 80002000 005a0000 00000020 00000202 00020002 40000000 02000400 | 04000000 41000208 2010010a 00010700 000010c0 02004400 02000000 00020000 00000910 000808c0 08300000 40008800 00800002 00211000 11240001 020e2008 08200000 22008000 00c00000 00020201 00001500 18000020 070040c0 08c01010 00004000 80002201 00080000 10800000 00000301 0006080a 40000000 02000640 |