On Target NPBW1_HUMAN 0.16239317/CHEMBL1989216
For the given ligand yong1, we have found in our database that, being scored 0.16239317, the most similar ligand is CHEMBL1989216. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1989216 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCOC(=O)C(C(=O)OCC)C1=C(Cl)C=NN(Cc2cccc3ccccc23)C1=O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00010014 42002608 30000180 00010618 000e0046 00208000 0004a000 00001060 06300100 810828c0 00002008 7001ba00 1700982a 08e00000 800c0000 000d200c 18020008 82004000 05200010 00220000 00010430 1c018b18 01800881 83700014 04107400 80000600 00128000 10040000 04000200 0006000a 00042000 00820020 |