On Target GRM1_HUMAN 0.2628205/CHEMBL254372
For the given ligand yong1, we have found in our database that, being scored 0.2628205, the most similar ligand is CHEMBL254372. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL254372 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | C=C1C[C@@H]2COC(=O)[C@]2(Cc3ccc4ccccc4c3)C1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00050040 81000008 00000102 80010300 00080000 00000000 00000000 00000400 00000800 00188848 08100000 40009000 04008008 00a00000 00080400 00081008 00820000 02000000 00402008 00000001 00000120 08000a08 01000040 00400010 00000c00 80002000 00000000 80000000 00000202 81020002 24020000 00000400 |