On Target CXCR1_HUMAN 0.18769231/CHEMBL3906175
For the given ligand yong1, we have found in our database that, being scored 0.18769231, the most similar ligand is CHEMBL3906175. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL3906175 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CCOC(=O)[C@@H]1CCCN1C(=O)c2cccc(NC3=C(NC(C4CCCS4)c5oc(C)cc5)C(=O)C3=O)c2F |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 1041c08a c3205800 e0180302 8a112700 24090081 08002818 800002a0 222d1500 05e04d40 071b48d0 00380034 5043b880 ce098c5f 41241008 800a9468 100811c8 16874601 22008c00 0863aa30 26000241 40100da0 18168e00 33000300 2658001c 04841430 c0000280 04d04010 9c0c0581 60588302 a006c023 a4045024 43012600 |