On Target HRH4_HUMAN 0.19572954/CHEMBL1935450
For the given ligand yong1, we have found in our database that, being scored 0.19572954, the most similar ligand is CHEMBL1935450. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL1935450 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | Nc1nc(N2CCNCC2)c3CCC4=C([C@H]5CCCC[C@H]5O4)c3n1 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 000b0042 01100809 40000bb2 4c9d0751 2708000d 000040c2 c100b000 08004c03 00400900 001c0250 a831a204 4001b800 8c020002 00b02800 03120426 011c100c 00a48c04 0e004000 02426008 40200003 04100420 26040001 27a0c8e0 02018113 01242401 82000201 60406001 8000b2c0 0809425e 20460002 64021480 200122e0 |