On Target BKRB2_HUMAN 0.1762295/CHEMBL384617
For the given ligand yong1, we have found in our database that, being scored 0.1762295, the most similar ligand is CHEMBL384617. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL384617 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | N[C@H](CCCN=C(N)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)N2CC(O)C[C@H]2C(=O)NCC(=O)N[C@@H](Cc3cccs3)C(=O)N[C@@H](CO)C(=O)N[C@]4(Cc5ccccc5)C(=O)C(Cc6ccccc6)N(CC(=O)N[C@@H](CCCN=C(N)N)C(=O)O)C4=O |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 00070000 01007600 00100102 04010e00 00180082 00000010 00010080 2000000c 00300980 004809e2 08302210 c003b080 1e00a01a 0120200b 82182000 100c4008 10000802 02000008 00c06018 00000205 00000900 783c0eb0 03000083 83500018 02403801 86000004 40010000 10000204 0c000002 0006001b 38024000 00c12e10 |