On Target 5HT1A_HUMAN 0.27234042/CHEMBL180405
For the given ligand yong1, we have found in our database that, being scored 0.27234042, the most similar ligand is CHEMBL180405. Check out the elaboration below.
| yong1 (Given Ligand) | CHEMBL180405 (Similar Ligand) |
|---|---|
| [H][C@@]12/C(CO)=C\[C@H](OC)[C@]1([H])/C(C(=O)OC)=C\O[C@H]2OC3OC(CO)C(O)C(O)C3O | CC1(C)OC2C=CC=CC2=C1OCCN3CCC(CC3)Oc4ccc5OCC(=O)Nc5c4 |
|
|
|
|
|
|
| 00050040 81000000 00000801 90010101 80290041 00000801 00022880 28011402 01200000 015080e8 48000200 40419011 8402802a 02800000 02000405 012a9008 00820004 00000100 1145e010 00008a01 00100020 00001a90 0500a000 08100010 00201420 80201400 00405002 a4000020 00004240 00000000 1ea0a000 00000010 | 0400640a 81040208 20101108 90010683 d0403081 06000001 02000000 20001442 00022008 001008c0 402c0204 5041c200 88828002 08120000 0308104d 0009e40c 10260090 80000000 28804090 0002a601 41102021 18041600 3740a080 08108810 10401401 80000400 28480048 908000a1 0000c242 00060001 0484a000 06024250 |