On Target CCR1_HUMAN 0.41025642/CHEMBL391301
For the given ligand Aspirin, we have found in our database that, being scored 0.41025642, the most similar ligand is CHEMBL391301. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL391301 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | C[C@@H]1CN(Cc2ccc(F)cc2)[C@@H](C)CN1C(=O)COc3ccc(Cl)cc3C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 0400a000 10003808 20100108 06010602 00001080 00024010 06000000 02001808 00010100 00010840 00240000 4000c820 02808806 00003000 81181401 00082008 10000000 82028500 00000000 00120200 00000000 38068f20 12000021 0240001c 00002000 c0000000 00100808 80000001 08000300 00068801 e0044000 00020200 |