On Target CXCR3_HUMAN 0.328/CHEMBL3952475
For the given ligand Aspirin, we have found in our database that, being scored 0.328, the most similar ligand is CHEMBL3952475. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3952475 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1cc(CN(Cc2ccc(cc2)C(=O)O)[C@H](C)c3ccc(Cl)cc3)ccc1OCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 0402a000 44005808 20100108 40250602 00001080 00004010 02040000 22001000 00000100 000808c0 08200000 40009800 8680c866 00000000 01081401 02088008 10002000 02000000 00080000 00020201 00020000 18068f20 12000000 0044801c 00002000 c0000000 00a60000 90000001 00000302 0006000b c0040000 00820680 |