On Target GRM3_HUMAN 0.30769232/CHEMBL4099470
For the given ligand Aspirin, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL4099470. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL4099470 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1ccccc1C(=O)N[C@H]2C[C@](N)([C@H]3[C@@H]2[C@@H]3C(=O)O)C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00030000 01001c08 20100108 00010600 00181000 00020100 02000000 22001400 00200000 001209c0 08200000 4003b000 0400883a 03800000 01000401 00082008 00000000 02000000 02402000 00020201 00000000 180e8e30 03000000 0050001c 00000000 c0000000 00000800 90000000 00000300 01060011 a4060000 00800a00 |