On Target NK2R_HUMAN 0.33544305/CHEMBL394531
For the given ligand test1, we have found in our database that, being scored 0.33544305, the most similar ligand is CHEMBL394531. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL394531 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O=C(NC1(CCCC1)C(=O)N[C@H](Cc2ccccc2)C(=O)NCCCN3CCOCC3)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010000 0100b600 00100100 84010600 00000080 00000000 80100080 2000040c 01800880 004809e0 08300800 4001b000 0600800a 00012001 8008100a 000c0108 30000400 02000100 0001a008 00801201 00000100 382c0610 12000003 83500018 00000c00 80000000 00482000 50010001 0c400200 0106001b 24004000 02002600 |