On Target GRM5_HUMAN 0.33333334/CHEMBL1783985
For the given ligand test1, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL1783985. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL1783985 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | O=C(C1CCC1)N2CCCC3(CCCCC3)C2 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00010000 01001000 00100000 00000400 00000000 00000000 00000000 20000000 00000000 00000080 00200000 50011000 04008002 00000010 00000000 00000000 00000000 00000000 02002000 00000201 00000000 10040610 00000000 00100018 00000000 00000000 00000000 10000000 00000000 00040001 00020000 00002200 |