On Target 5HT6R_HUMAN 0.3480663/CHEMBL97518
For the given ligand test1, we have found in our database that, being scored 0.3480663, the most similar ligand is CHEMBL97518. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL97518 (Similar Ligand) |
|---|---|
| CCCCCC(O)C(O)C2/C=C\CC1CC(=O)NCCCCNCCCN12 | CC[C@@](C)(CO)CNC(=O)[C@H]1CN(C)[C@@H]2Cc3c[nH]c4cccc(C2=C1)c34 |
|
|
|
|
|
|
| 00010010 89009400 00100800 00000400 00080080 00000000 00180000 20000402 00200000 001081a8 00200200 41031000 0c028102 00810000 00080404 00080108 30000000 00000140 00c12012 00002201 00000000 10040610 07008080 00100018 00201001 00000000 00484000 90000000 00000000 00040411 24020000 02002200 | 00000012 2910dc00 01900302 41910610 00041100 00000000 800820c0 20000402 004008c0 001909ea 08300004 41009000 98028902 00610800 00000042 000e020c 20000400 02000144 00e20412 00000201 40000500 1a348608 21808080 91400018 01243001 80000000 08482048 d0000000 04404000 00260c13 24040200 02012620 |