On Target NPY5R_HUMAN 0.08064516/CHEMBL469173
For the given ligand Asprin, we have found in our database that, being scored 0.08064516, the most similar ligand is CHEMBL469173. Check out the elaboration below.
| Asprin (Given Ligand) | CHEMBL469173 (Similar Ligand) |
|---|---|
| C=C1CCCC1 | OC1=C(C2C3=C(CC4(CCCC4)CC3=O)Oc5ccccc25)C(=O)CC6(CCCC6)C1 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000400 00000000 00100000 00000000 40000000 00000000 00000000 00000400 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 80000000 00000000 01000000 04000000 00000000 | 04010002 01000008 2000010a 0001030a 00081800 82800000 06000081 00000602 01040808 009a8840 08900000 40009040 8482802a 00a00000 13000401 00083408 00800600 22108020 00652008 0a020801 00000101 18000288 01008000 0c480c10 00600800 c0000000 00405040 80000000 00004302 81024002 24060000 00000400 |