On Target 5HT1F_HUMAN 0.04901961/CHEMBL361061
For the given ligand chongqian, we have found in our database that, being scored 0.04901961, the most similar ligand is CHEMBL361061. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL361061 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CN1CCC(CC1)N2CCc3ccc(NC(=O)c4ccc(F)cc4)cc23 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00004002 01000c00 00100100 42010600 28000000 00000050 00000800 02001000 00000080 000809e0 08280004 5001c000 00008802 00109000 00220140 00000002 00048000 02000100 08000000 00100201 60100000 18228600 20012000 81500015 00080000 80100000 00000400 90001081 04888100 00068013 80040000 20002600 |