On Target CNR2_HUMAN 0.27272728/CHEMBL3360190
For the given ligand chongqian, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL3360190. Check out the elaboration below.
| chongqian (Given Ligand) | CHEMBL3360190 (Similar Ligand) |
|---|---|
| CC2CCCC(C1CCCCCC1)CC2 | CC1(C)C[C@H]2[C@H]1CC\C=C\CCC2=C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00001000 00000000 00000000 00020000 00000000 | 00000000 01000000 00000000 00000000 00010000 00000000 00000000 00000402 00000000 00100000 00000000 40400000 00020000 00000010 00000400 00000000 00000000 00000000 00002000 00000001 00000000 00000000 00008000 00000010 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 |