On Target GABR1_HUMAN 0.22413793/CHEMBL2391908
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.22413793, the most similar ligand is CHEMBL2391908. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL2391908 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | Cl.C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c2ccc(Cl)c(Cl)c2 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 00008008 0d000200 00100100 00010600 00000080 80000000 04000000 02001000 00000400 00080848 08200001 40108800 02000876 01060000 8e000400 00080008 1000002c 02300000 02006000 00000201 00000000 19108100 03400000 00480010 08002000 c0100000 00040000 80014000 00140b00 00060302 70060000 0102d601 |