On Target GRM1_HUMAN 0.4467005/CHEMBL178741
For the given ligand MITRAGYNINE, we have found in our database that, being scored 0.4467005, the most similar ligand is CHEMBL178741. Check out the elaboration below.
| MITRAGYNINE (Given Ligand) | CHEMBL178741 (Similar Ligand) |
|---|---|
| CCC4CN3CCc1c([nH]c2cccc(OC)c12)C3CC4/C(=C\OC)C(=O)OC | CO[C@@H]1CC[C@@H](CC1)C(=O)c2ccc3nc4CCCCCc4cc3c2 |
|
|
|
|
|
|
| 0001000a 4300c808 2010010a 51010f10 000c1020 80100002 070c2000 22003409 11400880 003908c0 08318004 50819000 9400889e 21e08000 03020461 020c010c 00824201 06000026 006c2418 00060201 40120100 18218a18 21804000 91500010 00142000 c0002001 08325000 90000080 04004306 00860002 24068200 20246630 | 0001000a 01004800 00004102 10810310 000c1121 00000002 01002000 00000001 00400800 00080840 08108004 40809000 04008828 00e00800 00020060 020c000c 01800000 06000004 02602408 00000001 40100100 08068208 21804000 80400014 00040000 80000001 08000040 00000080 00400206 00820002 80060000 20000400 |