On Target GRM6_HUMAN 0.21186441/CHEMBL2381649
For the given ligand YJING, we have found in our database that, being scored 0.21186441, the most similar ligand is CHEMBL2381649. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL2381649 (Similar Ligand) |
|---|---|
| Fc4ccc(COc2ccc(CNCC1CCCCC1)cc2OCc3ccc(F)cc3)cc4 | CC(=O)N[C@H]1C[C@](N)([C@H]2[C@@H]1[C@@H]2C(=O)O)C(=O)O |
|
|
|
|
|
|
| 04000000 45000008 20100108 02210600 00001000 00004010 02040000 22001000 00000100 000008c0 00200000 40018000 00804802 00011080 01000401 02088008 00000000 02000200 02482000 00120201 00000000 18008030 00000000 00d49010 00000000 c0002000 00220000 90000001 00000300 00068008 60060000 00000200 | 00030000 01001400 00100000 00000400 00180000 00000000 00000000 20000000 00200000 00020180 00200000 40033000 0400803a 03800000 00000000 00080008 00000000 00000000 02402000 00000201 00000000 100c0e30 03000000 00100018 00000000 00000000 00000000 10000000 00000000 01040011 00020000 00800a00 |