On Target CXCR3_HUMAN 0.41428572/CHEMBL3952475
For the given ligand YJING, we have found in our database that, being scored 0.41428572, the most similar ligand is CHEMBL3952475. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3952475 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(CN(Cc2ccc(cc2)C(=O)O)[C@H](C)c3ccc(Cl)cc3)ccc1OCCN4C(=O)CCC4=O |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 0402a000 44005808 20100108 40250602 00001080 00004010 02040000 22001000 00000100 000808c0 08200000 40009800 8680c866 00000000 01081401 02088008 10002000 02000000 00080000 00020201 00020000 18068f20 12000000 0044801c 00002000 c0000000 00a60000 90000001 00000302 0006000b c0040000 00820680 |