On Target PTAFR_HUMAN 0.34453782/CHEMBL297624
For the given ligand YJING, we have found in our database that, being scored 0.34453782, the most similar ligand is CHEMBL297624. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL297624 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | COc1cc(cc(OC)c1OC)[C@H]2CC[C@@H](O2)c3cc(OC)c(OC)c(OC)c3 |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 00000001 4b000008 2000010a 00010200 00081010 40004000 42040000 00000000 00000900 00080848 08100000 40008000 00004002 20210000 01080005 02088008 00000000 02000204 00482000 00020a01 00000120 08000020 01000000 00400010 00000400 80002000 005a0000 00000000 00000202 0002000a 40000000 02000400 |