On Target CXCR2_HUMAN 0.30769232/CHEMBL376621
For the given ligand YJING, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL376621. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL376621 (Similar Ligand) |
|---|---|
| N=C(N)NNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3 | CN(C)S(=O)(=O)c1c(Cl)ccc(N\C(=N\C#N)\Nc2ccccc2OCc3ccccc3)c1O |
|
|
|
|
|
|
| 0400800c 4c000028 20000108 00210e00 00001000 00004000 02040000 00001002 00000100 00000842 00000000 40008800 02804886 00010080 21000001 0208800c 00000000 02000800 84480000 00020200 00040000 08008120 40000000 00c89000 00202000 80002000 40260000 00000000 00000220 004e0008 40040000 00020080 | 04008016 00800018 21000108 00b10a40 80001200 00024000 12000000 01002001 00040100 00004842 10242004 60008840 02804006 0001000b 81200151 0208c208 00842a00 0a000000 08400000 00026300 d0020102 08002120 20420400 08c31008 0090a800 80082000 60080808 0000008c 00008690 20060004 40000000 06034068 |