On Target GRM2_HUMAN 0.43661973/CHEMBL1098389
For the given ligand suplatast, we have found in our database that, being scored 0.43661973, the most similar ligand is CHEMBL1098389. Check out the elaboration below.
| suplatast (Given Ligand) | CHEMBL1098389 (Similar Ligand) |
|---|---|
| CCOCC(O)COc1ccc(NC(=O)CC[S+](C)C)cc1.Cc1ccc(S(=O)(=O)[O-])cc1 | Cc1ccc(OCC2CN(C(=O)O2)c3ccccc3)cc1 |
|
|
|
|
|
|
| 04004002 00801008 20100108 00d10640 20001040 02000000 02004000 00000208 00000000 01084840 00282004 60009000 00818022 00140002 81220241 00082008 04040000 02000000 09000000 00422000 c0100020 18000600 25002200 0a400018 00000600 80000000 00040000 408000a0 02008200 00060021 02000000 01010220 | 04004002 00405009 20101708 00010600 20001080 02008000 02040000 00000000 00002204 00000840 002c0004 40018010 00808002 00100000 01221041 00182008 00268000 02800000 08800802 00420000 40100000 18100d10 37002082 08400018 00000000 80000002 18020000 008000c0 00008200 80060001 80000000 00000240 |