On Target GASR_HUMAN 0.6847826/CHEMBL298705
For the given ligand Xanax, we have found in our database that, being scored 0.6847826, the most similar ligand is CHEMBL298705. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL298705 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Cc1nnc2C(NC(=O)Nc3ccc(Cl)cc3)N=C(c4ccccc4)c5ccccc5n12 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0080800e 01040019 40200500 98010e80 53000040 00980006 10800004 09607403 00000900 00280841 0b2d2124 44008c00 02008884 01108208 00061040 000c248c 08049800 02420025 08400000 00241801 400a0101 2803a500 61022000 00400118 00902010 e00004c0 40080040 400210c1 0000909c 00860803 c4040081 a6364600 |