On Target AA1R_HUMAN 0.33846155/CHEMBL3317566
For the given ligand Xanax, we have found in our database that, being scored 0.33846155, the most similar ligand is CHEMBL3317566. Check out the elaboration below.
| Xanax (Given Ligand) | CHEMBL3317566 (Similar Ligand) |
|---|---|
| Cc3nnc4CN=C(c1ccccc1)c2cc(Cl)ccc2n34 | Nc1nc(Cc2ccccc2Cl)nc3cn(nc13)c4ccccc4 |
|
|
|
|
|
|
| 0080800a 04040019 40200500 98010680 41000040 00880006 14800000 01201401 00000100 00080845 09010124 44008c00 02000884 00008208 80060040 000c248c 0a008800 02020205 00400000 00240000 40020000 2801a100 61000000 00400110 00802010 e00004c0 40080040 40021001 0000009c 00860c02 c0040080 a4260400 | 0000800e 80800208 20081500 18090620 01080060 0008c000 04009000 00001800 10100500 000d18c0 09008004 40819800 02000806 00800000 010200c0 020c008c 10000000 02000009 01600000 00260400 c0000400 18018160 21800840 83400010 00102000 80000200 08010000 00000800 0400000c 0046080a 48040000 a02605e0 |