On Target GRM6_HUMAN 0.05263158/CHEMBL2418359
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.05263158, the most similar ligand is CHEMBL2418359. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL2418359 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | O=C(N1C[C@@H]2CN(c3ccccn3)C[C@@H]2C1)N1CCC2(CCCC2)C1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00004002 01001400 00104000 00000e00 20040000 00002010 00000004 20102000 00200000 200001e0 00200004 40030000 00009802 00000000 00020000 00040004 00040000 00004000 08202040 00a00201 60100100 1c0d8410 20800800 00300018 00010000 00000000 00000080 10000080 00008018 01060811 001a1000 00002200 |