On Target MC4R_HUMAN 0.0875/CHEMBL1330113
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.0875, the most similar ligand is CHEMBL1330113. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL1330113 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | Cl.N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(Cl)cc1)NC(=N)Nc1ccc(Cl)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00008006 01000010 00100000 00000e00 00000000 00000000 00000004 00002001 00000200 000008e2 02200006 40018802 02001004 00000000 00000040 00300000 00040000 00000000 08002000 00000001 40020100 18030110 20020000 00100010 00112000 00000000 40080000 30000080 01009010 00060000 80080001 06024200 |