On Target DRD2_HUMAN 0.097222224/CHEMBL132575
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.097222224, the most similar ligand is CHEMBL132575. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL132575 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CCCN(CCC)C1CCC2=C(CCC/C2=N\O)C1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000000 09000000 00900000 00000c00 00000000 00040000 00080040 30002402 10100040 0010008b 00210000 41010000 00020002 10000000 00000400 00300010 00004000 00000060 10002000 00000201 00000000 10030010 00008000 00104010 00200000 00000000 40404000 90000000 04000010 00040400 040a0000 00002200 |