On Target ACM1_HUMAN 0.1521739/CHEMBL477542
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.1521739, the most similar ligand is CHEMBL477542. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL477542 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | N=C(N)NCCCCCCCCC(=O)C(N)CCCNC(=N)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00010000 01000000 00100000 00000c00 00000000 00000000 00000000 00002000 00200200 00000082 00200000 40033000 04009018 00000000 00000000 00100000 00000000 00000000 00002000 00000001 00000000 10010210 00000000 00100010 00000000 00000000 40000000 10000000 00000010 00040000 800a0000 00000200 |