On Target GRM5_HUMAN 0.14130434/CHEMBL380626
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.14130434, the most similar ligand is CHEMBL380626. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL380626 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | CN1CCC/C1=N\C(=O)Nc1cccc(Cl)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00008042 00000001 00100000 02000e00 22000020 00000010 18000000 00006003 00000200 001008c3 10290024 40008800 02008006 01100019 00001840 00500000 00040800 00000000 08000000 20004001 40102001 18000500 20002008 00001810 00902210 00000000 40001000 900000c0 00008010 00060001 06000000 00024200 |