On Target 5HT1B_HUMAN 0.1097561/CHEMBL366322
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.1097561, the most similar ligand is CHEMBL366322. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL366322 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | Cc1cc(C(C)(C)C)cc(C)c1NC1=NCCN1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00000006 00000810 40000100 40010e00 00000001 00000002 00020404 01002001 00000000 000a0842 18200014 40008000 00002000 0000800c 00020040 00180008 00040800 02400020 08000000 00000000 40220100 28010000 20020000 00400010 00100080 80000000 40000000 00001080 0a008090 00060002 00000100 04004600 |