On Target OPRD_HUMAN 0.11111111/CHEMBL1587149
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.11111111, the most similar ligand is CHEMBL1587149. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL1587149 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | COc1ccc(CN2CN=C(Nc3nc(C)cc(C)n3)N(Cc3ccc(OC)cc3)C2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 08000042 00000808 20000108 80050e00 23001024 00084000 02c42004 42003000 00000700 00000872 17202027 40108800 00000802 04100008 01021001 003c000c 00004800 02004000 00400040 00a20000 00100100 0c03a400 20800850 00400100 00010010 81010100 40220000 b0001000 0000031c 00460802 41040001 800002a0 |