On Target CXCR2_HUMAN 0.07258064/CHEMBL376540
For the given ligand CN(C)C(=N)/N=C(N)/N, we have found in our database that, being scored 0.07258064, the most similar ligand is CHEMBL376540. Check out the elaboration below.
| CN(C)C(=N)/N=C(N)/N (Given Ligand) | CHEMBL376540 (Similar Ligand) |
|---|---|
| CN(C)C(=N)/N=C(N)\N | Cc1ccc(N/C(=N/C#N)Nc2ccccc2Br)c(O)c1S(=O)(=O)N(C)C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000800 02000000 00000000 00000000 00002000 00000000 00000002 00200020 00000000 00000000 00000008 00001000 00000000 00000800 00000000 00000000 00000000 00000000 00000800 00000000 00000000 00000010 00010000 40000000 00000000 00000010 00040000 00000000 00000000 | 00004016 44808818 21000100 00b10a40 00000200 00020000 02000000 01002001 00060000 00000842 10202004 60008040 00004012 00008009 803001d0 0000c208 00842a80 0a000000 08400000 00026300 d0020102 08002100 20020400 084b0008 0010a000 80000000 60020800 0000008c 00008490 20060004 00000008 0c014268 |