On Target ADA1D_HUMAN 0.38333333/CHEMBL926
For the given ligand test1, we have found in our database that, being scored 0.38333333, the most similar ligand is CHEMBL926. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL926 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | CC(CCc1ccc(O)cc1)NCCc1ccc(O)c(O)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 43000208 20100102 00010600 00000000 80000000 02000000 20000000 00000880 000808c0 08300000 40008000 00000002 00200000 00000000 00048008 00000000 02000000 00000000 00020201 00000100 18200000 00000000 81400010 00000000 80000000 00120000 10000000 04000000 0006000a 00000000 00002600 |