On Target NK1R_HUMAN 0.45614034/CHEMBL305274
For the given ligand test1, we have found in our database that, being scored 0.45614034, the most similar ligand is CHEMBL305274. Check out the elaboration below.
| test1 (Given Ligand) | CHEMBL305274 (Similar Ligand) |
|---|---|
| CCCc1ccc(C)c(C)c1 | Cc1cc(C)cc(COCC(N)Cc2ccccc2)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000001 00000000 00000000 00000000 00000900 00080840 08100000 40008800 00000000 00200000 00000000 00080008 00000000 02000000 00000000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00000000 00000400 | 00000000 00000008 00000100 80010700 00000011 00004000 00000000 00000000 00000900 00080840 08101000 40008000 00000000 00010000 00001000 02081008 00000000 02000000 00400000 40000001 00000120 18000020 03000040 81400010 00000400 80002000 00080000 00000000 04000200 00060002 40000004 02000400 |