On Target GABR1_HUMAN 0.13675214/CHEMBL392394
For the given ligand Acetaminophen, we have found in our database that, being scored 0.13675214, the most similar ligand is CHEMBL392394. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL392394 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CSc1nc(NC2CCCC2)c(c(NC3CCCC3)n1)[N+](=O)[O-] |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00014002 01000110 00180220 08182620 20000000 00006000 00009800 00100900 14000100 000000a0 00200004 40011000 04010101 00000000 00060000 000c0014 04141040 04004000 00400000 80200001 00120200 18040000 20804040 00980010 00080004 90500000 40040400 10000080 00084008 01460000 40001000 080102c0 |