On Target NK2R_HUMAN 0.28703704/CHEMBL303119
For the given ligand Acetaminophen, we have found in our database that, being scored 0.28703704, the most similar ligand is CHEMBL303119. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL303119 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CN(C)C(=O)c1ccc(c2ccc(Cl)cc2)c(c1)N(C)C(=O)c3cc(cc(c3)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 1000e002 000a0800 40100100 40010600 04000001 08000040 10000400 02081000 00800100 00000850 00280104 4000c802 82008804 01100000 00020040 18000008 04060000 02002000 0c000000 10000000 40100000 18028700 30012000 00440004 00042000 80000000 08040010 900010c0 2040c100 01060003 80140800 01020200 |