On Target MC4R_HUMAN 0.3970588/CHEMBL1728670
For the given ligand Acetaminophen, we have found in our database that, being scored 0.3970588, the most similar ligand is CHEMBL1728670. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL1728670 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CCCCCCCN([C@@H]1C[C@H]2CCCC(=O)N3CC[C@@H](C1)[C@@H]23)c4ccccc4 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00014002 01001000 00100000 00000600 20000000 00002010 00000000 20000000 00200000 000008c0 00200004 40039000 0400800a 00000000 00020040 00000000 00040000 00000000 0a002000 80000201 40100000 18040630 20000000 00100018 00000000 00000000 00000000 10000080 00008000 00060001 00020000 00002200 |