On Target MC3R_HUMAN 0.25373134/CHEMBL377231
For the given ligand Acetaminophen, we have found in our database that, being scored 0.25373134, the most similar ligand is CHEMBL377231. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL377231 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | COc1cc(Cl)ccc1CC(C)C(=O)N2CCN(CC2)c3ccc(cc3[C@@H](N)CC(C)C)C(F)(F)F |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 0000c002 01032a08 2010012a 04010600 00001001 00000040 97000400 20001208 00000800 20080ad0 08300004 40009842 06008826 0120a002 01020041 000c2008 00248000 02000000 08000008 00820201 40100100 38008700 21000021 0240041a 00002800 c0000000 08040200 90001080 08088300 0006800b 00140080 60020600 |