On Target MSHR_HUMAN 0.24183007/CHEMBL606399
For the given ligand Acetaminophen, we have found in our database that, being scored 0.24183007, the most similar ligand is CHEMBL606399. Check out the elaboration below.
| Acetaminophen (Given Ligand) | CHEMBL606399 (Similar Ligand) |
|---|---|
| CC(=O)Nc1ccc(O)cc1 | CC(C)N(C(=O)CN1C=CN(C(=O)C(Cc2n[nH]c3ccccc23)C1=O)c4ccccc4)c5ccc(O)cc5 |
|
|
|
|
|
|
| 00004002 00000008 20000000 00000600 00000000 00000000 02000000 00000000 00000000 00000840 00280004 40008000 00008022 00100000 00000040 00000008 00040000 00000000 08000000 00020000 40100000 08000600 20002000 00000000 00000000 00000000 00040000 00000080 00008000 00060001 00000000 00000200 | 00404002 00002608 20100122 04012600 29040000 00002002 02000220 20000608 00000920 000c0be0 08388004 7000b040 0e008022 00702000 80020040 0004204c 00240001 26008000 08600218 60220261 60508100 3d000608 24802801 0260001a 00103800 a0000000 00160000 10080180 08008006 2406801b 22004020 00004620 |